CAS 13109-99-4 is the registry number for 1-(5-Nitrothiazol-2-yl)pyrrolidin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(5-nitro-1,3-thiazol-2-yl)pyrrolidin-2-one (CAS 13109-99-4) is a chemical compound with the molecular formula C7H7N3O3S and a molecular weight of 213.22 g/mol. IUPAC name: 1-(5-nitro-1,3-thiazol-2-yl)pyrrolidin-2-one. InChIKey: UBYUUYVSFQRSJR-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3S |
|---|---|
| Molecular weight | 213.22 g/mol |
| IUPAC name | 1-(5-nitro-1,3-thiazol-2-yl)pyrrolidin-2-one |
| InChIKey | UBYUUYVSFQRSJR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=NC=C(S2)[N+](=O)[O-] |
Computed by PubChem (NCBI)