CAS 1311162-36-3 is the registry number for 4,7-dichloro-2,9-bis(trichloromethyl)-1,10-phenanthroline, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
4,7-dichloro-2,9-bis(trichloromethyl)-1,10-phenanthroline (CAS 1311162-36-3) is a chemical compound with the molecular formula C14H4Cl8N2 and a molecular weight of 483.8 g/mol. IUPAC name: 4,7-dichloro-2,9-bis(trichloromethyl)-1,10-phenanthroline. InChIKey: LOGGIVHAGJGRFU-UHFFFAOYSA-N.
| Molecular formula | C14H4Cl8N2 |
|---|---|
| Molecular weight | 483.8 g/mol |
| IUPAC name | 4,7-dichloro-2,9-bis(trichloromethyl)-1,10-phenanthroline |
| InChIKey | LOGGIVHAGJGRFU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C1C(=CC(=N3)C(Cl)(Cl)Cl)Cl)N=C(C=C2Cl)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)