CAS 131124-82-8 appears in our catalog under these names: Boc-L-Tyr(PO3H2)-OH*DIPEA, Boc–L–Tyr(PO3H2)–OH DIPEA. Offered by: Creative Peptides, GLPBio. Available pack sizes: 1g, 5g, 250mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-phosphonooxyphenyl)propanoic acid (CAS 131124-82-8) is a chemical compound with the molecular formula C14H20NO8P and a molecular weight of 361.28 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-phosphonooxyphenyl)propanoic acid. InChIKey: NYDLNSAKSFUOLE-NSHDSACASA-N.
| Molecular formula | C14H20NO8P |
|---|---|
| Molecular weight | 361.28 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-phosphonooxyphenyl)propanoic acid |
| InChIKey | NYDLNSAKSFUOLE-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)OP(=O)(O)O)C(=O)O |
Computed by PubChem (NCBI)