CAS 1311314-23-4 is the registry number for (5-Fluoro-1-methyl-1H-1,3-benzodiazol-2-yl)methanamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
(5-fluoro-1-methylbenzimidazol-2-yl)methanamine;dihydrochloride (CAS 1311314-23-4) is a chemical compound with the molecular formula C9H12Cl2FN3 and a molecular weight of 252.11 g/mol. IUPAC name: (5-fluoro-1-methylbenzimidazol-2-yl)methanamine;dihydrochloride. InChIKey: ATRLZXNWGHTKHC-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2FN3 |
|---|---|
| Molecular weight | 252.11 g/mol |
| IUPAC name | (5-fluoro-1-methylbenzimidazol-2-yl)methanamine;dihydrochloride |
| InChIKey | ATRLZXNWGHTKHC-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)F)N=C1CN.Cl.Cl |
Computed by PubChem (NCBI)