CAS 1311314-58-5 appears in our catalog under these names: 2-((4-Aminopentyl)oxy)-1,3,5-tribromobenzene hydrochloride, 95%, 2-((4-Aminopentyl)oxy)-1,3,5-tribromobenzene hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
5-(2,4,6-tribromophenoxy)pentan-2-amine;hydrochloride (CAS 1311314-58-5) is a chemical compound with the molecular formula C11H15Br3ClNO and a molecular weight of 452.41 g/mol. IUPAC name: 5-(2,4,6-tribromophenoxy)pentan-2-amine;hydrochloride. InChIKey: HANKKHGUOLHWGL-UHFFFAOYSA-N.
| Molecular formula | C11H15Br3ClNO |
|---|---|
| Molecular weight | 452.41 g/mol |
| IUPAC name | 5-(2,4,6-tribromophenoxy)pentan-2-amine;hydrochloride |
| InChIKey | HANKKHGUOLHWGL-UHFFFAOYSA-N |
| SMILES | CC(CCCOC1=C(C=C(C=C1Br)Br)Br)N.Cl |
Computed by PubChem (NCBI)