CAS 1311314-95-0 appears in our catalog under these names: 2-Chloro-N-{(4-fluoro-2-(trifluoromethyl)phenyl)methyl}acetamide, 95%, 2-Chloro-N-{(4-fluoro-2-(trifluoromethyl)phenyl)methyl}acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-chloro-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]acetamide (CAS 1311314-95-0) is a chemical compound with the molecular formula C10H8ClF4NO and a molecular weight of 269.62 g/mol. IUPAC name: 2-chloro-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]acetamide. InChIKey: HRGWDZDMRIGQLM-UHFFFAOYSA-N.
| Molecular formula | C10H8ClF4NO |
|---|---|
| Molecular weight | 269.62 g/mol |
| IUPAC name | 2-chloro-N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]acetamide |
| InChIKey | HRGWDZDMRIGQLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(F)(F)F)CNC(=O)CCl |
Computed by PubChem (NCBI)