CAS 1311316-13-8 is the registry number for 5-Methyl-3-sulfanyl-(1,2,4)triazolo(3,4-b)(1,3)thiazole-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-methyl-3-sulfanylidene-2H-[1,3]thiazolo[2,3-c][1,2,4]triazole-6-carboxylic acid (CAS 1311316-13-8) is a chemical compound with the molecular formula C6H5N3O2S2 and a molecular weight of 215.3 g/mol. IUPAC name: 5-methyl-3-sulfanylidene-2H-[1,3]thiazolo[2,3-c][1,2,4]triazole-6-carboxylic acid. InChIKey: RVHKKUGGPFYLAX-UHFFFAOYSA-N.
| Molecular formula | C6H5N3O2S2 |
|---|---|
| Molecular weight | 215.3 g/mol |
| IUPAC name | 5-methyl-3-sulfanylidene-2H-[1,3]thiazolo[2,3-c][1,2,4]triazole-6-carboxylic acid |
| InChIKey | RVHKKUGGPFYLAX-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=NNC(=S)N12)C(=O)O |
Computed by PubChem (NCBI)