CAS 1311316-83-2 is the registry number for 4-(1-Amino-2-methylpropan-2-yl)thiomorpholine 1-oxide dihydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 10g, 5g.
2-methyl-2-(1-oxo-1,4-thiazinan-4-yl)propan-1-amine;dihydrochloride (CAS 1311316-83-2) is a chemical compound with the molecular formula C8H20Cl2N2OS and a molecular weight of 263.23 g/mol. IUPAC name: 2-methyl-2-(1-oxo-1,4-thiazinan-4-yl)propan-1-amine;dihydrochloride. InChIKey: UHKLYAAFRWJAFM-UHFFFAOYSA-N.
| Molecular formula | C8H20Cl2N2OS |
|---|---|
| Molecular weight | 263.23 g/mol |
| IUPAC name | 2-methyl-2-(1-oxo-1,4-thiazinan-4-yl)propan-1-amine;dihydrochloride |
| InChIKey | UHKLYAAFRWJAFM-UHFFFAOYSA-N |
| SMILES | CC(C)(CN)N1CCS(=O)CC1.Cl.Cl |
Computed by PubChem (NCBI)