CAS 1311318-29-2 appears in our catalog under these names: 5-Chloro-3-methylisoxazole-4-sulfonyl chloride, 95%, 5-Chloro-3-methyl-1,2-oxazole-4-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5-chloro-3-methyl-1,2-oxazole-4-sulfonyl chloride (CAS 1311318-29-2) is a chemical compound with the molecular formula C4H3Cl2NO3S and a molecular weight of 216.04 g/mol. IUPAC name: 5-chloro-3-methyl-1,2-oxazole-4-sulfonyl chloride. InChIKey: ALOGQQNILXOVHG-UHFFFAOYSA-N.
| Molecular formula | C4H3Cl2NO3S |
|---|---|
| Molecular weight | 216.04 g/mol |
| IUPAC name | 5-chloro-3-methyl-1,2-oxazole-4-sulfonyl chloride |
| InChIKey | ALOGQQNILXOVHG-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1S(=O)(=O)Cl)Cl |
Computed by PubChem (NCBI)