CAS 1311318-46-3 is the registry number for 1-(4-Chlorophenyl)-3,3-dimethylbutan-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(4-chlorophenyl)-3,3-dimethylbutan-2-amine;hydrochloride (CAS 1311318-46-3) is a chemical compound with the molecular formula C12H19Cl2N and a molecular weight of 248.19 g/mol. IUPAC name: 1-(4-chlorophenyl)-3,3-dimethylbutan-2-amine;hydrochloride. InChIKey: GOFXFSAGJUCZCI-UHFFFAOYSA-N.
| Molecular formula | C12H19Cl2N |
|---|---|
| Molecular weight | 248.19 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-3,3-dimethylbutan-2-amine;hydrochloride |
| InChIKey | GOFXFSAGJUCZCI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(CC1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)