Products 1311505-93-7
CAS 1311505-93-7 is the registry number for N-(4-Bromobenzyl)-N,2-dimethylthiazole-4-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(4-bromophenyl)methyl]-N,2-dimethyl-1,3-thiazole-4-carboxamide (CAS 1311505-93-7) is a chemical compound with the molecular formula C13H13BrN2OS and a molecular weight of 325.23 g/mol. IUPAC name: N-[(4-bromophenyl)methyl]-N,2-dimethyl-1,3-thiazole-4-carboxamide. InChIKey: PJDSVJAWRKPOPC-UHFFFAOYSA-N.
| Molecular formula | C13H13BrN2OS |
|---|---|
| Molecular weight | 325.23 g/mol |
| IUPAC name | N-[(4-bromophenyl)methyl]-N,2-dimethyl-1,3-thiazole-4-carboxamide |
| InChIKey | PJDSVJAWRKPOPC-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C(=O)N(C)CC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)