CAS 131170-44-0 is the registry number for Terephthalaldehyde-2,3,5,6-d4. Offered by: TRC. Available pack sizes: 50mg.
2,3,5,6-tetradeuterioterephthalaldehyde (CAS 131170-44-0) is a chemical compound with the molecular formula C8H6O2 and a molecular weight of 138.16 g/mol. IUPAC name: 2,3,5,6-tetradeuterioterephthalaldehyde. InChIKey: KUCOHFSKRZZVRO-RHQRLBAQSA-N.
| Molecular formula | C8H6O2 |
|---|---|
| Molecular weight | 138.16 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterioterephthalaldehyde |
| InChIKey | KUCOHFSKRZZVRO-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C=O)[2H])[2H])C=O)[2H] |
Computed by PubChem (NCBI)