Products 13118-77-9
CAS 13118-77-9 is the registry number for 7-Oxabicyclo[2.2.1]heptane-2-methanol, (1R,2R,4S)-rel-, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
[(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]methanol (CAS 13118-77-9) is a chemical compound with the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. IUPAC name: [(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]methanol. InChIKey: VCNMKDHFISMVQL-QYNIQEEDSA-N.
| Molecular formula | C7H12O2 |
|---|---|
| Molecular weight | 128.17 g/mol |
| IUPAC name | [(1S,2R,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]methanol |
| InChIKey | VCNMKDHFISMVQL-QYNIQEEDSA-N |
| SMILES | C1C[C@H]2[C@H](C[C@@H]1O2)CO |
Computed by PubChem (NCBI)