CAS 131180-45-5 is the registry number for (2S)-alpha,alpha-Bis(4-Fluorophenyl)-2-Pyrrolidinemethanol. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg.
Bis(4-fluorophenyl)-[(2S)-pyrrolidin-2-yl]methanol (CAS 131180-45-5) is a chemical compound with the molecular formula C17H17F2NO and a molecular weight of 289.32 g/mol. IUPAC name: bis(4-fluorophenyl)-[(2S)-pyrrolidin-2-yl]methanol. InChIKey: MFOIELLUBQRIOJ-INIZCTEOSA-N.
| Molecular formula | C17H17F2NO |
|---|---|
| Molecular weight | 289.32 g/mol |
| IUPAC name | bis(4-fluorophenyl)-[(2S)-pyrrolidin-2-yl]methanol |
| InChIKey | MFOIELLUBQRIOJ-INIZCTEOSA-N |
| SMILES | C1C[C@H](NC1)C(C2=CC=C(C=C2)F)(C3=CC=C(C=C3)F)O |
Computed by PubChem (NCBI)