CAS 131182-91-7 is the registry number for 2-([2-Nitro-4-(trifluoromethyl)phenyl]thio)-1,3-benzothiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1,3-benzothiazole (CAS 131182-91-7) is a chemical compound with the molecular formula C14H7F3N2O2S2 and a molecular weight of 356.3 g/mol. IUPAC name: 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1,3-benzothiazole. InChIKey: SEGPVSGEMQVJSQ-UHFFFAOYSA-N.
| Molecular formula | C14H7F3N2O2S2 |
|---|---|
| Molecular weight | 356.3 g/mol |
| IUPAC name | 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-1,3-benzothiazole |
| InChIKey | SEGPVSGEMQVJSQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)SC3=C(C=C(C=C3)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)