CAS 1312117-74-0 appears in our catalog under these names: tert-Butyl N-{4H,5H,6H-cyclopenta(b)thiophen-2-yl}carbamate, TERT-BUTYL N-(4H,5H,6H-CYCLOPENTA[B]THIOPHEN-2-YL)CARBAMATE, 97%, 97%, tert-butyl N-{4H,5H,6H-cyclopenta[b]thiophen-2-yl}carbamate, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
Tert-butyl N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)carbamate (CAS 1312117-74-0) is a chemical compound with the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. IUPAC name: tert-butyl N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)carbamate. InChIKey: LLIIQRRYFRWRMS-UHFFFAOYSA-N.
| Molecular formula | C12H17NO2S |
|---|---|
| Molecular weight | 239.34 g/mol |
| IUPAC name | tert-butyl N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)carbamate |
| InChIKey | LLIIQRRYFRWRMS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC2=C(S1)CCC2 |
Computed by PubChem (NCBI)