Products 1312226-08-6
CAS 1312226-08-6 is the registry number for 1-(5-Methyl-1H-indol-3-yl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(5-methyl-1H-indol-3-yl)ethanone (CAS 1312226-08-6) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 1-(5-methyl-1H-indol-3-yl)ethanone. InChIKey: HLLSLFIMBXEYCB-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 1-(5-methyl-1H-indol-3-yl)ethanone |
| InChIKey | HLLSLFIMBXEYCB-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC=C2C(=O)C |
Computed by PubChem (NCBI)