CAS 1312309-62-8 appears in our catalog under these names: 8-Boc-3,6-dioxaoctyl methanesulfonate, 97%, 97%, Mes-peg2-acid t-butyl ester, 95%, Ms-PEG2-C2-Boc, Ms–PEG2–C2–Boc, Ms-PEG2-t-butyl ester. Offered by: Chemat, Combi-blocks, TargetMol, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 5g, 10mg, 25mg, 1000mg, 1 g.
Tert-butyl 3-[2-(2-methylsulfonyloxyethoxy)ethoxy]propanoate (CAS 1312309-62-8) is a chemical compound with the molecular formula C12H24O7S and a molecular weight of 312.38 g/mol. IUPAC name: tert-butyl 3-[2-(2-methylsulfonyloxyethoxy)ethoxy]propanoate. InChIKey: SXMMBKJCRVIEEX-UHFFFAOYSA-N.
| Molecular formula | C12H24O7S |
|---|---|
| Molecular weight | 312.38 g/mol |
| IUPAC name | tert-butyl 3-[2-(2-methylsulfonyloxyethoxy)ethoxy]propanoate |
| InChIKey | SXMMBKJCRVIEEX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOS(=O)(=O)C |
Computed by PubChem (NCBI)