CAS 13124-85-1 is the registry number for trimethyl 5–bromobenzene–1,2,4–tricarboxylate. Offered by: GLPBio. Available pack sizes: 200mg.
Trimethyl 5-bromobenzene-1,2,4-tricarboxylate (CAS 13124-85-1) is a chemical compound with the molecular formula C12H11BrO6 and a molecular weight of 331.12 g/mol. IUPAC name: trimethyl 5-bromobenzene-1,2,4-tricarboxylate. InChIKey: JOXRYAVXVYKMPQ-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO6 |
|---|---|
| Molecular weight | 331.12 g/mol |
| IUPAC name | trimethyl 5-bromobenzene-1,2,4-tricarboxylate |
| InChIKey | JOXRYAVXVYKMPQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1C(=O)OC)Br)C(=O)OC |
Computed by PubChem (NCBI)