CAS 1312478-48-0 is the registry number for (R)-Ethyl-4-bromo-2-methyl-2-(methylsulfonyl)butanoate. Offered by: TRC. Available pack sizes: 25mg.
Ethyl (2R)-4-bromo-2-methyl-2-methylsulfonylbutanoate (CAS 1312478-48-0) is a chemical compound with the molecular formula C8H15BrO4S and a molecular weight of 287.17 g/mol. IUPAC name: ethyl (2R)-4-bromo-2-methyl-2-methylsulfonylbutanoate. InChIKey: DRDIKYRQXJWIIX-MRVPVSSYSA-N.
| Molecular formula | C8H15BrO4S |
|---|---|
| Molecular weight | 287.17 g/mol |
| IUPAC name | ethyl (2R)-4-bromo-2-methyl-2-methylsulfonylbutanoate |
| InChIKey | DRDIKYRQXJWIIX-MRVPVSSYSA-N |
| SMILES | CCOC(=O)[C@@](C)(CCBr)S(=O)(=O)C |
Computed by PubChem (NCBI)