Products 1312536-54-1
CAS 1312536-54-1 is the registry number for 7-(aminomethyl)isoindolin-1-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
7-(aminomethyl)-2,3-dihydroisoindol-1-one;hydrochloride (CAS 1312536-54-1) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. IUPAC name: 7-(aminomethyl)-2,3-dihydroisoindol-1-one;hydrochloride. InChIKey: HKYCOKHWYGRYDV-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | 7-(aminomethyl)-2,3-dihydroisoindol-1-one;hydrochloride |
| InChIKey | HKYCOKHWYGRYDV-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)CN)C(=O)N1.Cl |
Computed by PubChem (NCBI)