CAS 1312538-00-3 is the registry number for Trans-methyl 5-hydroxytetrahydro-2H-pyran-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2R,5S)-5-hydroxyoxane-2-carboxylate (CAS 1312538-00-3) is a chemical compound with the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. IUPAC name: methyl (2R,5S)-5-hydroxyoxane-2-carboxylate. InChIKey: CXCJZYYIQBOFPN-NTSWFWBYSA-N.
| Molecular formula | C7H12O4 |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | methyl (2R,5S)-5-hydroxyoxane-2-carboxylate |
| InChIKey | CXCJZYYIQBOFPN-NTSWFWBYSA-N |
| SMILES | COC(=O)[C@H]1CC[C@@H](CO1)O |
Computed by PubChem (NCBI)