CAS 1312679-00-7 appears in our catalog under these names: Methazolamide Sulfonic Acid, 5-(Acetylimino)-4,5-dihydro-4-methyl-1,3,4-thiadiazole-2-sulfonic Acid. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 250mg, 10mg, 5mg, 25mg, 100mg, 50mg.
5-acetylimino-4-methyl-1,3,4-thiadiazole-2-sulfonic acid (CAS 1312679-00-7) is a chemical compound with the molecular formula C5H7N3O4S2 and a molecular weight of 237.3 g/mol. IUPAC name: 5-acetylimino-4-methyl-1,3,4-thiadiazole-2-sulfonic acid. InChIKey: LBSHBVPQTKPFEI-UHFFFAOYSA-N.
| Molecular formula | C5H7N3O4S2 |
|---|---|
| Molecular weight | 237.3 g/mol |
| IUPAC name | 5-acetylimino-4-methyl-1,3,4-thiadiazole-2-sulfonic acid |
| InChIKey | LBSHBVPQTKPFEI-UHFFFAOYSA-N |
| SMILES | CC(=O)N=C1N(N=C(S1)S(=O)(=O)O)C |
Computed by PubChem (NCBI)