Products 131274-98-1
CAS 131274-98-1 appears in our catalog under these names: rac-(1R,2S,4S)-N-Methylbicyclo(2.2.1)heptan-2-amine hydrochloride, rac-(1R,2S,4S)-N-methylbicyclo[2.2.1]heptan-2-amine hydrochloride, 97%. Offered by: Biosynth, Chemat. Available pack sizes: 2,5g, 250mg, 100mg, 500mg, 1g.
(1S,2R,4R)-N-methylbicyclo[2.2.1]heptan-2-amine;hydrochloride (CAS 131274-98-1) is a chemical compound with the molecular formula C8H16ClN and a molecular weight of 161.67 g/mol. IUPAC name: (1S,2R,4R)-N-methylbicyclo[2.2.1]heptan-2-amine;hydrochloride. InChIKey: NGQMCJXJNPZWGI-ARIDFIBWSA-N.
| Molecular formula | C8H16ClN |
|---|---|
| Molecular weight | 161.67 g/mol |
| IUPAC name | (1S,2R,4R)-N-methylbicyclo[2.2.1]heptan-2-amine;hydrochloride |
| InChIKey | NGQMCJXJNPZWGI-ARIDFIBWSA-N |
| SMILES | CN[C@@H]1C[C@@H]2CC[C@H]1C2.Cl |
Computed by PubChem (NCBI)