Products 1312748-28-9
CAS 1312748-28-9 is the registry number for Rel-(1R,2S)-4,4-difluorocyclopentane-1,2-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1R,2S)-4,4-difluorocyclopentane-1,2-diamine (CAS 1312748-28-9) is a chemical compound with the molecular formula C5H10F2N2 and a molecular weight of 136.14 g/mol. IUPAC name: cis-(1R,2S)-4,4-difluorocyclopentane-1,2-diamine. InChIKey: YJBRVDQGZSWPGB-ZXZARUISSA-N.
| Molecular formula | C5H10F2N2 |
|---|---|
| Molecular weight | 136.14 g/mol |
| IUPAC name | cis-(1R,2S)-4,4-difluorocyclopentane-1,2-diamine |
| InChIKey | YJBRVDQGZSWPGB-ZXZARUISSA-N |
| SMILES | C1[C@H]([C@H](CC1(F)F)N)N |
Computed by PubChem (NCBI)