CAS 1312799-06-6 is the registry number for FFA2 agonist-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S,5R)-5-(2-chlorophenyl)-1-[4-(2-methoxyphenyl)benzoyl]pyrrolidine-2-carboxylic acid (CAS 1312799-06-6) is a chemical compound with the molecular formula C25H22ClNO4 and a molecular weight of 435.9 g/mol. IUPAC name: (2S,5R)-5-(2-chlorophenyl)-1-[4-(2-methoxyphenyl)benzoyl]pyrrolidine-2-carboxylic acid. InChIKey: MCVFKGHKDGYDHZ-YADHBBJMSA-N.
| Molecular formula | C25H22ClNO4 |
|---|---|
| Molecular weight | 435.9 g/mol |
| IUPAC name | (2S,5R)-5-(2-chlorophenyl)-1-[4-(2-methoxyphenyl)benzoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | MCVFKGHKDGYDHZ-YADHBBJMSA-N |
| SMILES | COC1=CC=CC=C1C2=CC=C(C=C2)C(=O)N3[C@H](CC[C@H]3C(=O)O)C4=CC=CC=C4Cl |
Computed by PubChem (NCBI)