CAS 131288-11-4 is the registry number for (R)-2-Benzylpiperazine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
(2R)-2-benzylpiperazine (CAS 131288-11-4) is a chemical compound with the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. IUPAC name: (2R)-2-benzylpiperazine. InChIKey: RITMXTLCKYLIKW-LLVKDONJSA-N.
| Molecular formula | C11H16N2 |
|---|---|
| Molecular weight | 176.26 g/mol |
| IUPAC name | (2R)-2-benzylpiperazine |
| InChIKey | RITMXTLCKYLIKW-LLVKDONJSA-N |
| SMILES | C1CN[C@@H](CN1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)