Products 1312941-07-3

CAS 1312941-07-3 is the registry number for 3-Methoxy-4-(2-morpholinoethoxy)benzoic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-methoxy-4-(2-morpholin-4-ylethoxy)benzoic acid;hydrochloride (CAS 1312941-07-3) is a chemical compound with the molecular formula C14H20ClNO5 and a molecular weight of 317.76 g/mol. IUPAC name: 3-methoxy-4-(2-morpholin-4-ylethoxy)benzoic acid;hydrochloride. InChIKey: JQKKKHPJCDLRKP-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20ClNO5
Molecular weight317.76 g/mol
IUPAC name3-methoxy-4-(2-morpholin-4-ylethoxy)benzoic acid;hydrochloride
InChIKeyJQKKKHPJCDLRKP-UHFFFAOYSA-N
SMILESCOC1=C(C=CC(=C1)C(=O)O)OCCN2CCOCC2.Cl

Computed by PubChem (NCBI)