CAS 1312943-26-2 appears in our catalog under these names: Arbidol Impurity 10, Ethyl 5-acetoxy-6,7-dibromo-2-(bromomethyl)-1-methyl-1H-indole-3-carboxylate, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg.
Ethyl 5-acetyloxy-6,7-dibromo-2-(bromomethyl)-1-methylindole-3-carboxylate (CAS 1312943-26-2) is a chemical compound with the molecular formula C15H14Br3NO4 and a molecular weight of 512.0 g/mol. IUPAC name: ethyl 5-acetyloxy-6,7-dibromo-2-(bromomethyl)-1-methylindole-3-carboxylate. InChIKey: LVNIPIKVDNAYOR-UHFFFAOYSA-N.
| Molecular formula | C15H14Br3NO4 |
|---|---|
| Molecular weight | 512.0 g/mol |
| IUPAC name | ethyl 5-acetyloxy-6,7-dibromo-2-(bromomethyl)-1-methylindole-3-carboxylate |
| InChIKey | LVNIPIKVDNAYOR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C2=C(C(=C(C=C12)OC(=O)C)Br)Br)C)CBr |
Computed by PubChem (NCBI)