Products 1312954-58-7
CAS 1312954-58-7 is the registry number for Fotagliptin, 99.05%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 100 mg, 50 mg, 10 mg, 25 mg.
2-[[3-[(3R)-3-aminopiperidin-1-yl]-6-methyl-5-oxo-1,2,4-triazin-4-yl]methyl]-4-fluorobenzonitrile (CAS 1312954-58-7) is a chemical compound with the molecular formula C17H19FN6O and a molecular weight of 342.4 g/mol. IUPAC name: 2-[[3-[(3R)-3-aminopiperidin-1-yl]-6-methyl-5-oxo-1,2,4-triazin-4-yl]methyl]-4-fluorobenzonitrile. InChIKey: IXSWMXRAIPXMRH-OAHLLOKOSA-N.
| Molecular formula | C17H19FN6O |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 2-[[3-[(3R)-3-aminopiperidin-1-yl]-6-methyl-5-oxo-1,2,4-triazin-4-yl]methyl]-4-fluorobenzonitrile |
| InChIKey | IXSWMXRAIPXMRH-OAHLLOKOSA-N |
| SMILES | CC1=NN=C(N(C1=O)CC2=C(C=CC(=C2)F)C#N)N3CCC[C@H](C3)N |
Computed by PubChem (NCBI)