CAS 1313012-28-0 appears in our catalog under these names: 4-((Trifluoromethyl)thio)benzene-1,2-diamine dihydrochloride, 95%, 4–((Trifluoromethyl)thio)benzene–1,2–diamine dihydrochloride, 4-((Trifluoromethyl)thio)benzene-1,2-diamine dihydrochloride, 97%, 97%, 4-((Trifluoromethyl)thio)benzene-1,2-diamine dihydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 100mg, 25mg.
4-(trifluoromethylsulfanyl)benzene-1,2-diamine;dihydrochloride (CAS 1313012-28-0) is a chemical compound with the molecular formula C7H9Cl2F3N2S and a molecular weight of 281.13 g/mol. IUPAC name: 4-(trifluoromethylsulfanyl)benzene-1,2-diamine;dihydrochloride. InChIKey: YPVPAPUNFXTHPC-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2F3N2S |
|---|---|
| Molecular weight | 281.13 g/mol |
| IUPAC name | 4-(trifluoromethylsulfanyl)benzene-1,2-diamine;dihydrochloride |
| InChIKey | YPVPAPUNFXTHPC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1SC(F)(F)F)N)N.Cl.Cl |
Computed by PubChem (NCBI)