CAS 1313019-65-6 appears in our catalog under these names: Sc-1, 95%, Compound SC-1/ 99.41% (existing batch purity), SC–1, SC 1, 1-(4-Chloro-3-(trifluoromethyl)phenyl)-3-(4-(4-cyanophenoxy)phenyl)urea 98+%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 100mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 200mg.
1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-(4-cyanophenoxy)phenyl]urea (CAS 1313019-65-6) is a chemical compound with the molecular formula C21H13ClF3N3O2 and a molecular weight of 431.8 g/mol. IUPAC name: 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-(4-cyanophenoxy)phenyl]urea. InChIKey: HVPZDXDXIQZKHU-UHFFFAOYSA-N.
| Molecular formula | C21H13ClF3N3O2 |
|---|---|
| Molecular weight | 431.8 g/mol |
| IUPAC name | 1-[4-chloro-3-(trifluoromethyl)phenyl]-3-[4-(4-cyanophenoxy)phenyl]urea |
| InChIKey | HVPZDXDXIQZKHU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)OC2=CC=C(C=C2)NC(=O)NC3=CC(=C(C=C3)Cl)C(F)(F)F |
Computed by PubChem (NCBI)