Products 1313183-82-2
CAS 1313183-82-2 is the registry number for (2S)-2-(benzyloxycarbonylamino)-3-(4-carbamoylphenyl)propanoic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
(2S)-3-(4-carbamoylphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 1313183-82-2) is a chemical compound with the molecular formula C18H18N2O5 and a molecular weight of 342.3 g/mol. IUPAC name: (2S)-3-(4-carbamoylphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: UVIAOAFSKDDWPF-HNNXBMFYSA-N.
| Molecular formula | C18H18N2O5 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | (2S)-3-(4-carbamoylphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | UVIAOAFSKDDWPF-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CC2=CC=C(C=C2)C(=O)N)C(=O)O |
Computed by PubChem (NCBI)