CAS 13132-88-2 is the registry number for 3-Acetoxy Bromazepam. Offered by: TRC, Biosynth. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg.
(7-bromo-2-oxo-5-pyridin-2-yl-1,3-dihydro-1,4-benzodiazepin-3-yl) acetate (CAS 13132-88-2) is a chemical compound with the molecular formula C16H12BrN3O3 and a molecular weight of 374.19 g/mol. IUPAC name: (7-bromo-2-oxo-5-pyridin-2-yl-1,3-dihydro-1,4-benzodiazepin-3-yl) acetate. InChIKey: JGADGCUKQFAHSU-UHFFFAOYSA-N.
| Molecular formula | C16H12BrN3O3 |
|---|---|
| Molecular weight | 374.19 g/mol |
| IUPAC name | (7-bromo-2-oxo-5-pyridin-2-yl-1,3-dihydro-1,4-benzodiazepin-3-yl) acetate |
| InChIKey | JGADGCUKQFAHSU-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1C(=O)NC2=C(C=C(C=C2)Br)C(=N1)C3=CC=CC=N3 |
Computed by PubChem (NCBI)