CAS 131322-08-2 appears in our catalog under these names: Tri-tert-butylphosphonium tetraphenylborate, 98%, Tri–tert–butylphosphonium Tetraphenylborate, Tri-tert-butylphosphonium Tetraphenylborate, >98.0%(HPLC)(T), Tri-tert-butylphosphoniumtetraphenylborate, ≥98%, ≥98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 250mg, 25mg, 100mg.
Tetraphenylboranuide;tritert-butylphosphanium (CAS 131322-08-2) is a chemical compound with the molecular formula C36H48BP and a molecular weight of 522.6 g/mol. IUPAC name: tetraphenylboranuide;tritert-butylphosphanium. InChIKey: QWISVPBFGJWCBS-UHFFFAOYSA-O.
| Molecular formula | C36H48BP |
|---|---|
| Molecular weight | 522.6 g/mol |
| IUPAC name | tetraphenylboranuide;tritert-butylphosphanium |
| InChIKey | QWISVPBFGJWCBS-UHFFFAOYSA-O |
| SMILES | [B-](C1=CC=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.CC(C)(C)[PH+](C(C)(C)C)C(C)(C)C |
Computed by PubChem (NCBI)