CAS 1313498-08-6 appears in our catalog under these names: LSN2814617, (Rac)-LSN2814617. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 5 mg, 1 mg, 10 mg, 25 mg.
5-[(7S)-3-tert-butyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-3-(4-fluorophenyl)-1,2,4-oxadiazole (CAS 1313498-08-6) is a chemical compound with the molecular formula C18H20FN5O and a molecular weight of 341.4 g/mol. IUPAC name: 5-[(7S)-3-tert-butyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-3-(4-fluorophenyl)-1,2,4-oxadiazole. InChIKey: NPRJTKMKUYJGAL-LBPRGKRZSA-N.
| Molecular formula | C18H20FN5O |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 5-[(7S)-3-tert-butyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-3-(4-fluorophenyl)-1,2,4-oxadiazole |
| InChIKey | NPRJTKMKUYJGAL-LBPRGKRZSA-N |
| SMILES | CC(C)(C)C1=NN=C2N1CC[C@@H](C2)C3=NC(=NO3)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)