CAS 1313617-73-0 is the registry number for (5-Chloro-2-methanesulfonylphenyl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(5-chloro-2-methylsulfonylphenyl)boronic acid (CAS 1313617-73-0) is a chemical compound with the molecular formula C7H8BClO4S and a molecular weight of 234.47 g/mol. IUPAC name: (5-chloro-2-methylsulfonylphenyl)boronic acid. InChIKey: WZEQQRDBOUXJKK-UHFFFAOYSA-N.
| Molecular formula | C7H8BClO4S |
|---|---|
| Molecular weight | 234.47 g/mol |
| IUPAC name | (5-chloro-2-methylsulfonylphenyl)boronic acid |
| InChIKey | WZEQQRDBOUXJKK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)S(=O)(=O)C)(O)O |
Computed by PubChem (NCBI)