CAS 1313712-18-3 is the registry number for 6-Bromo-1-(2-trimethylsilanyl-ethoxymethyl)-1h-[1,2,3]triazolo[4,5-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 2g, 250mg.
2-[(6-bromotriazolo[4,5-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane (CAS 1313712-18-3) is a chemical compound with the molecular formula C11H17BrN4OSi and a molecular weight of 329.27 g/mol. IUPAC name: 2-[(6-bromotriazolo[4,5-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane. InChIKey: IFUKSOSLGPJPHG-UHFFFAOYSA-N.
| Molecular formula | C11H17BrN4OSi |
|---|---|
| Molecular weight | 329.27 g/mol |
| IUPAC name | 2-[(6-bromotriazolo[4,5-b]pyridin-1-yl)methoxy]ethyl-trimethylsilane |
| InChIKey | IFUKSOSLGPJPHG-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)CCOCN1C2=C(N=CC(=C2)Br)N=N1 |
Computed by PubChem (NCBI)