CAS 1313712-43-4 appears in our catalog under these names: 4-Bromo-3-bis(tert-butoxycarbonyl)amino-thiophene-2-carboxylic acid methyl ester, 95%, 4-Bromo-3-bis(tert-butoxycarbonyl)amino-thiophene-2-carboxylic acid methyl ester, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
Methyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-bromothiophene-2-carboxylate (CAS 1313712-43-4) is a chemical compound with the molecular formula C16H22BrNO6S and a molecular weight of 436.3 g/mol. IUPAC name: methyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-bromothiophene-2-carboxylate. InChIKey: NVALAXBVOBNNKF-UHFFFAOYSA-N.
| Molecular formula | C16H22BrNO6S |
|---|---|
| Molecular weight | 436.3 g/mol |
| IUPAC name | methyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-bromothiophene-2-carboxylate |
| InChIKey | NVALAXBVOBNNKF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=C(SC=C1Br)C(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)