CAS 1313712-44-5 is the registry number for 7-Bromo-2,6-dimethyl-thieno[3,2-d]pyrimidin-4-ylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
7-bromo-2,6-dimethylthieno[3,2-d]pyrimidin-4-amine (CAS 1313712-44-5) is a chemical compound with the molecular formula C8H8BrN3S and a molecular weight of 258.14 g/mol. IUPAC name: 7-bromo-2,6-dimethylthieno[3,2-d]pyrimidin-4-amine. InChIKey: ZDPDZMBXDAMDFZ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrN3S |
|---|---|
| Molecular weight | 258.14 g/mol |
| IUPAC name | 7-bromo-2,6-dimethylthieno[3,2-d]pyrimidin-4-amine |
| InChIKey | ZDPDZMBXDAMDFZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(S1)C(=NC(=N2)C)N)Br |
Computed by PubChem (NCBI)