Products 1313712-57-0
CAS 1313712-57-0 is the registry number for N,N'-Diboc-2-amino-6-fluorobenzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl N-(2-cyano-3-fluorophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 1313712-57-0) is a chemical compound with the molecular formula C17H21FN2O4 and a molecular weight of 336.36 g/mol. IUPAC name: tert-butyl N-(2-cyano-3-fluorophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: IXEGHFOYPBBQRQ-UHFFFAOYSA-N.
| Molecular formula | C17H21FN2O4 |
|---|---|
| Molecular weight | 336.36 g/mol |
| IUPAC name | tert-butyl N-(2-cyano-3-fluorophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | IXEGHFOYPBBQRQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=C(C(=CC=C1)F)C#N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)