CAS 1313731-99-5 appears in our catalog under these names: TGN-020 sodium 99%, TGN-020 sodium, 98%, TGN–020 sodium, TGN-020 (sodium), 98%, 98%, TGN-020 (sodium), 99.96%. Offered by: Ambeed, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 10mg, 5mg, 50 mg, 100 mg.
Sodium pyridine-3-carbonyl(1,3,4-thiadiazol-2-yl)azanide (CAS 1313731-99-5) is a chemical compound with the molecular formula C8H5N4NaOS and a molecular weight of 228.21 g/mol. IUPAC name: sodium pyridine-3-carbonyl(1,3,4-thiadiazol-2-yl)azanide. InChIKey: YVHWOCDMDRVSHB-UHFFFAOYSA-M.
| Molecular formula | C8H5N4NaOS |
|---|---|
| Molecular weight | 228.21 g/mol |
| IUPAC name | sodium pyridine-3-carbonyl(1,3,4-thiadiazol-2-yl)azanide |
| InChIKey | YVHWOCDMDRVSHB-UHFFFAOYSA-M |
| SMILES | C1=CC(=CN=C1)C(=O)[N-]C2=NN=CS2.[Na+] |
Computed by PubChem (NCBI)