Products 1313734-77-8
CAS 1313734-77-8 appears in our catalog under these names: Ricinine-d3, >95% (HPLC), RICININE-(METHYL-D3), 98 ATOM % D, 98% &, Ricinine-d3. Offered by: TRC, Sigma-Aldrich, MedChemExpress. Available pack sizes: 2mg, 50mg, 5mg, 5 mg, 1 mg.
4-methoxy-2-oxo-1-(trideuteriomethyl)pyridine-3-carbonitrile (CAS 1313734-77-8) is a chemical compound with the molecular formula C8H8N2O2 and a molecular weight of 167.18 g/mol. IUPAC name: 4-methoxy-2-oxo-1-(trideuteriomethyl)pyridine-3-carbonitrile. InChIKey: PETSAYFQSGAEQY-FIBGUPNXSA-N.
| Molecular formula | C8H8N2O2 |
|---|---|
| Molecular weight | 167.18 g/mol |
| IUPAC name | 4-methoxy-2-oxo-1-(trideuteriomethyl)pyridine-3-carbonitrile |
| InChIKey | PETSAYFQSGAEQY-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1C=CC(=C(C1=O)C#N)OC |
Computed by PubChem (NCBI)