CAS 1313738-90-7 appears in our catalog under these names: PGMI-004A, 98+%, PGMI-004A, 99.34%, 99.34%, PGMI-004A, 98.87%. Offered by: AmBeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 50 mg, 10mM/1mL, 25 mg, 5 mg.
3,4-dihydroxy-9,10-dioxo-N-[4-(trifluoromethyl)phenyl]anthracene-2-sulfonamide (CAS 1313738-90-7) is a chemical compound with the molecular formula C21H12F3NO6S and a molecular weight of 463.4 g/mol. IUPAC name: 3,4-dihydroxy-9,10-dioxo-N-[4-(trifluoromethyl)phenyl]anthracene-2-sulfonamide. InChIKey: XKVNBCMGEUDKNP-UHFFFAOYSA-N.
| Molecular formula | C21H12F3NO6S |
|---|---|
| Molecular weight | 463.4 g/mol |
| IUPAC name | 3,4-dihydroxy-9,10-dioxo-N-[4-(trifluoromethyl)phenyl]anthracene-2-sulfonamide |
| InChIKey | XKVNBCMGEUDKNP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=CC(=C(C(=C3C2=O)O)O)S(=O)(=O)NC4=CC=C(C=C4)C(F)(F)F |
Computed by PubChem (NCBI)