Products 1313739-03-5
CAS 1313739-03-5 is the registry number for tert-Butyl 4-(2,2,2-trifluoro-1-(hydroxyimino)ethyl)piperidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 500mg.
Tert-butyl 4-[(E)-N-hydroxy-C-(trifluoromethyl)carbonimidoyl]piperidine-1-carboxylate (CAS 1313739-03-5) is a chemical compound with the molecular formula C12H19F3N2O3 and a molecular weight of 296.29 g/mol. IUPAC name: tert-butyl 4-[(E)-N-hydroxy-C-(trifluoromethyl)carbonimidoyl]piperidine-1-carboxylate. InChIKey: BEDQXXYBOFAGNO-CXUHLZMHSA-N.
| Molecular formula | C12H19F3N2O3 |
|---|---|
| Molecular weight | 296.29 g/mol |
| IUPAC name | tert-butyl 4-[(E)-N-hydroxy-C-(trifluoromethyl)carbonimidoyl]piperidine-1-carboxylate |
| InChIKey | BEDQXXYBOFAGNO-CXUHLZMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)/C(=N\O)/C(F)(F)F |
Computed by PubChem (NCBI)