CAS 1313739-04-6 appears in our catalog under these names: 4,4-Difluoroadamantane-1-carboxylic acid methyl ester, 95%, Methyl 4,4–difluoroadamantane–1–carboxylate, 4,4-DifluoroadaMantan-1-carboxylic acid Methyl ester, 95%, 95%, Methyl 4,4-difluoroadamantane-1-carboxylate, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 500mg, 100mg.
Methyl 4,4-difluoroadamantane-1-carboxylate (CAS 1313739-04-6) is a chemical compound with the molecular formula C12H16F2O2 and a molecular weight of 230.25 g/mol. IUPAC name: methyl 4,4-difluoroadamantane-1-carboxylate. InChIKey: IRSQDTPPCWEWKW-UHFFFAOYSA-N.
| Molecular formula | C12H16F2O2 |
|---|---|
| Molecular weight | 230.25 g/mol |
| IUPAC name | methyl 4,4-difluoroadamantane-1-carboxylate |
| InChIKey | IRSQDTPPCWEWKW-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC3CC(C1)C(C(C3)C2)(F)F |
Computed by PubChem (NCBI)