CAS 1313855-66-1 is the registry number for 4-Nitrobenzyl morpholine-4-carbodithioate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(4-nitrophenyl)methyl morpholine-4-carbodithioate (CAS 1313855-66-1) is a chemical compound with the molecular formula C12H14N2O3S2 and a molecular weight of 298.4 g/mol. IUPAC name: (4-nitrophenyl)methyl morpholine-4-carbodithioate. InChIKey: ZGEUXOYPPBYZSB-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O3S2 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | (4-nitrophenyl)methyl morpholine-4-carbodithioate |
| InChIKey | ZGEUXOYPPBYZSB-UHFFFAOYSA-N |
| SMILES | C1COCCN1C(=S)SCC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)