CAS 1314-80-3 appears in our catalog under these names: Phosphorus Pentasulfide, Phosphorus pentasulfide, 98+%, PHOSPHORUS PENTASULFIDE, 99%. Offered by: TRC, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 10g, 2,5g, 25g, 1KG, 500g, 100G, 5G.
1,3,5,7-tetrakis(sulfanylidene)-2,4,6,8,9,10-hexathia-1lambda5,3lambda5,5lambda5,7lambda5-tetraphosphatricyclo[3.3.1.13,7]decane (CAS 1314-80-3) is a chemical compound with the molecular formula P4S10 and a molecular weight of 444.6 g/mol. IUPAC name: 1,3,5,7-tetrakis(sulfanylidene)-2,4,6,8,9,10-hexathia-1lambda5,3lambda5,5lambda5,7lambda5-tetraphosphatricyclo[3.3.1.13,7]decane. InChIKey: CYQAYERJWZKYML-UHFFFAOYSA-N.
| Molecular formula | P4S10 |
|---|---|
| Molecular weight | 444.6 g/mol |
| IUPAC name | 1,3,5,7-tetrakis(sulfanylidene)-2,4,6,8,9,10-hexathia-1lambda5,3lambda5,5lambda5,7lambda5-tetraphosphatricyclo[3.3.1.13,7]decane |
| InChIKey | CYQAYERJWZKYML-UHFFFAOYSA-N |
| SMILES | P12(=S)SP3(=S)SP(=S)(S1)SP(=S)(S2)S3 |
Computed by PubChem (NCBI)