CAS 13140-29-9 is the registry number for Perfluoro-3-methoxypropanoic Acid (PFMOPrA). Offered by: Chemat Brand. Available pack sizes: on request.
2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propanoic acid (CAS 13140-29-9) is a chemical compound with the molecular formula C4HF7O3 and a molecular weight of 230.04 g/mol. IUPAC name: 2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propanoic acid. InChIKey: JFIQYUFQLKYFPJ-UHFFFAOYSA-N.
| Molecular formula | C4HF7O3 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propanoic acid |
| InChIKey | JFIQYUFQLKYFPJ-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(F)(F)F)(OC(F)(F)F)F)O |
Computed by PubChem (NCBI)