Products 13140-29-9

CAS 13140-29-9 is the registry number for Perfluoro-3-methoxypropanoic Acid (PFMOPrA). Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propanoic acid (CAS 13140-29-9) is a chemical compound with the molecular formula C4HF7O3 and a molecular weight of 230.04 g/mol. IUPAC name: 2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propanoic acid. InChIKey: JFIQYUFQLKYFPJ-UHFFFAOYSA-N.

Identity
Molecular formulaC4HF7O3
Molecular weight230.04 g/mol
IUPAC name2,3,3,3-tetrafluoro-2-(trifluoromethoxy)propanoic acid
InChIKeyJFIQYUFQLKYFPJ-UHFFFAOYSA-N
SMILESC(=O)(C(C(F)(F)F)(OC(F)(F)F)F)O

Computed by PubChem (NCBI)