CAS 1314018-44-4 is the registry number for Betovumeline. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(1R,5R)-3-azabicyclo[3.1.0]hexan-1-yl]-3-methyl-1,2,4-oxadiazole (CAS 1314018-44-4) is a chemical compound with the molecular formula C8H11N3O and a molecular weight of 165.19 g/mol. IUPAC name: 5-[(1R,5R)-3-azabicyclo[3.1.0]hexan-1-yl]-3-methyl-1,2,4-oxadiazole. InChIKey: FTFZIXZMGKRLHO-XPUUQOCRSA-N.
| Molecular formula | C8H11N3O |
|---|---|
| Molecular weight | 165.19 g/mol |
| IUPAC name | 5-[(1R,5R)-3-azabicyclo[3.1.0]hexan-1-yl]-3-methyl-1,2,4-oxadiazole |
| InChIKey | FTFZIXZMGKRLHO-XPUUQOCRSA-N |
| SMILES | CC1=NOC(=N1)[C@]23C[C@H]2CNC3 |
Computed by PubChem (NCBI)